| Identification | |
| Name: | D-Tyrosine |
| Synonyms: | (R)-3-(p-Hydroxyphenyl)alanine;D-Tyrosin;(R)-2-Amino-3-(p-hydroxyphenyl)propionic acid;H-D-Tyr-OH;D-Tyrosine(556-02-5); |
| CAS: | 556-02-5 |
| EINECS: | 209-112-6 |
| Molecular Formula: | C9H11NO3 |
| Molecular Weight: | 181.19 |
| InChI: | InChI=1/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 186.7oC |
| Density: | 1.333g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | 11.3 o (C=5, 1N HCL) |
| Water Solubility: | SOLUBLE |
| Solubility: | soluble |
| Appearance: | white crystals |
| Specification: | white to off-white powder Safety Statements:26-36-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes |
| HS Code: | 29225000 |
| Flash Point: | 186.7oC |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
