| Identification | ||
| Name: | Benzoic acid,4-(acetylamino)- | |
| Synonyms: | Benzoicacid, p-acetamido- (6CI,7CI,8CI);4-(Acetylamino)benzoic acid;4-Acetamidobenzoic acid;4'-Carboxyacetanilide;Acedoben;N-Acetyl-p-aminobenzoicacid;NSC 4002;p-(Acetoamino)benzoic acid;p-(Acetylamino)benzoic acid;p-Acetamidobenzoic acid;p-Acetaminobenzoic acid; | |
| CAS: | 556-08-1 | |
| EINECS: | 209-114-7 | |
| Molecular Formula: | C9H9NO3 | |
| Molecular Weight: | 179.17 | |
| InChI: | InChI=1/C9H9NO3/c1-6(11)10-8-4-2-7(3-5-8)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13) | |
| Molecular Structure: |  |
|
| Properties | ||
| Density: | 1.326 g/cm3 | |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | |
| Water Solubility: | <0.1 g/100 mL at 21 ºC | |
| Solubility: | <0.1 g/100 mL at 21 ºC in water | |
| Appearance: | White to beige in colour crystalline powder | |
| Specification: | white or off-white powder or crystals Safety Statements:24/25 24/25:Avoid contact with skin and eyes | |
| HS Code: | 29242995 | |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. | |
| Usage: | Used for the enhancement of the immune response in patients with persistent generalised lymphadenopathy at risk of developing acquired immunodeficiency syndrome (aids). | |
| Safety Data | ||
 |
||
