| Identification | |
| Name: | 3-Methyl-2-buten-1-ol |
| Synonyms: | Prenyl alcohol; 3,3-Dimethylallyl alcohol; Prenol; Isopentenyl Alcohol; 3-methylbut-2-en-1-ol; Prenol; Isoamylene 3-methyl-2-buten-1-ol |
| CAS: | 556-82-1 |
| EINECS: | 209-141-4 |
| Molecular Formula: | C5H10O |
| Molecular Weight: | 86.13 |
| InChI: | InChI=1/C5H10O/c1-5(2)3-4-6/h3,6H,4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1987 |
| Melting Point: | -86 |
| Density: | 0.848 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.442-1.444 |
| Solubility: | 170 g/L (20 ºC) in water |
| Appearance: | colorless liquid with fruity odor |
| Specification: |
3-Methyl-2-buten-1-ol (CAS No.556-82-1), it also can be called 3,3-Dimethylallyl alcohol ; Prenyl alcohol ; 2-Buten-1-ol, 3-methyl- ; 2-Methyl-2-buten-4-ol ; 3-Methylbut-2-en-1-ol . It is clear colourless to very slightly yellow liquid. 3-Methyl-2-buten-1-ol (CAS No.556-82-1) is a natural alcohol. It is one of the most simple terpenes. It is a clear colorless oil that is reasonably soluble in water and miscible with most common organic solvents. |
| Report: |
3-Methyl-2-buten-1-ol (CAS No.556-82-1) is reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29052990 |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
