| Identification | |
| Name: | Clophen A 30 |
| Synonyms: | CLOPHENA |
| CAS: | 55600-34-5 |
| Molecular Formula: | C12H8Cl2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C12H8Cl2/c13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 150.5°C |
| Boiling Point: | 324.7°Cat760mmHg |
| Density: | 1.249g/cm3 |
| Specification: |
Clophen a-30 , its cas register number is 55600-34-5. It also can be called 3,3'-Dichlorobiphenyl . When heated to decomposition it emits acrid smoke and irritating fumes.Wear suitable protective clothing, gloves and eye/face protection when Contact with Clophen a-30 (CAS NO.55600-34-5). |
| Flash Point: | 150.5°C |
| Safety Data | |
 |
|
