| Identification |
| Name: | Urea,N'-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-N-(2-chloroethyl)-N-nitroso-,hydrochloride (1:1) |
| Synonyms: | Urea,N'-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-N-(2-chloroethyl)-N-nitroso-,monohydrochloride (9CI);1-(4-Amino-2-methylpyrimidin-5-yl)methyl-3-(2-chloroethyl)-3-nitrosoureahydrochloride;ACNU;NSC-D 245382;Nidran;Nimustine hydrochloride;3-[(4-Amino-2-methyl-5-pyrimidinyl)methyl]-1-(2-chloroethyl)-1-nitrosourea hydrochloride;N'-[(4-Amino-2-methyl-5-pyrimidinyl)methyl]-N-(2-chloroethyl)-N-nitrosourea hydrochloride;CS 439 HCl;CS-439;Nimustine HCl; |
| CAS: | 55661-38-6 |
| Molecular Formula: | C9H13ClN6O2.ClH |
| Molecular Weight: | 309.15246 |
| InChI: | InChI=1S/C9H13ClN6O2.ClH/c1-6-12-4-7(8(11)14-6)5-13-9(17)16(15-18)3-2-10;/h4H,2-3,5H2,1H3,(H,13,17)(H2,11,12,14);1H |
| Molecular Structure: |
![(C9H13ClN6O2.ClH) Urea,N'-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-N-(2-chloroethyl)-N-nitroso-,monohydrochloride (9CI...](https://img.guidechem.com/casimg/55661-38-6.gif) |
| Properties |
| Transport: | UN 2811 |
| Density: | 1.52g/cm3 |
| Water Solubility: | Soluble in methanol or water; slightly soluble in 100% ethanol or n-butanol |
| Solubility: | Soluble in methanol or water; slightly soluble in 100% ethanol or n-butanol |
| Appearance: | White to light yellow solid. |
| Specification: | Safety Statements:36/37/39-45 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |