| Identification | |
| Name: | 2-Bromopropene |
| Synonyms: | Bromopropene,90%; 2-Bromo-1-propene; Isopropenyl bromide |
| CAS: | 557-93-7 |
| EINECS: | 209-185-4 |
| Molecular Formula: | C3H5Br |
| Molecular Weight: | 120.9758 |
| InChI: | InChI=1S/C3H5Br/c1-3(2)4/h1H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 250kgs |
| Melting Point: | -87°C |
| Density: | 1.36 |
| Stability: | Stable. Highly flammable. Incompatible with strong oxidizing agents, strong bases. |
| Refractive index: | n20/D 1.4436(lit.) |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | clear liquid |
| Specification: | light yellow-green liquid Safety Statements:23-26-36 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | II |
| Storage Temperature: | −20°C |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
F:Highlyflammable
Xi:Irritant
|
 |
|
