| Identification | |
| Name: | 2,6-Octadienenitrile,3,7-dimethyl-, (2E)- |
| Synonyms: | 2,6-Octadienenitrile,3,7-dimethyl-, (E)- (8CI); Geranonitrile (6CI);(E)-3,7-Dimethyl-2,6-octadienenitrile |
| CAS: | 5585-39-7 |
| EINECS: | 226-982-2 |
| Molecular Formula: | C10H15 N |
| Molecular Weight: | 149.26 |
| InChI: | InChI=1/C10H15N/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 9/PG 3 |
| Flash Point: | 103.7°C |
| Boiling Point: | 247.9°Cat760mmHg |
| Density: | 0.858g/cm3 |
| Refractive index: | n20/D 1.475(lit.) |
| Specification: | Safety Statements:36/37-61 36/37:Wear suitable protective clothing and gloves 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Report: |
Reported in EPA TSCA Inventory. Cyanide and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 103.7°C |
| Safety Data | |
 |
|
