| Identification |
| Name: | Kathon 886 |
| Synonyms: | ProClin 300;KKM 43;Isocil RW;Kathon 886MW;Zonen F;Kathon WT;Kathon LX;HX-89 Coating Antiseptic;3(2H)-Isothiazolone,5-chloro-2-methyl-,mixt. with 2-methyl-3(2H)-isothiazolone;HX-99-A Liquid Complex Preservative;Kathon CG/ICP;Kathon LX Plus;Legend MK;HX-90 Pulp Antiseptic;Acticide 14;Kathon RH 886;Kathon CG;MBC 215;Amerstat 252;Tret-O-Lite XC 215;HX-99-B Liquid Complex Preservative;Kathon biocide;Bio-Perge;Acticide RS;Kathon;Isothiazolinone Chloride;Isothiazoline-one ( Kathon, MIT/CMIT ); |
| CAS: | 55965-84-9 |
| Molecular Formula: | C4H5NOS•C4H4ClNOS |
| Molecular Weight: | 264.76 |
| InChI: | InChI=1S/C4H4ClNOS.C4H5NOS/c1-6-4(7)2-3(5)8-6;1-5-4(6)2-3-7-5/h2H,1H3;2-3H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.25 |
| Appearance: | Enzyme conjugate (red), Standard set (pale Red to deep Red due to concentration), Control serum (yellow) |
| Safety Data |
| |
 |
