| Identification | |
| Name: | 2-Amino-4,6-dihydroxypyrimidine |
| Synonyms: | 2-amino-6-hydroxy-3H-pyrimidin-4-one;2-Amino-4,6-dioxypyrimidine;4(1H)-Pyrimidinone, 2-amino-6-hydroxy-;4 (1H)-Pyrimidinone, 2-amino-6-hydroxy-;2-Amino-6-hydroxy-4(1H)-pyrimidinone;2-Amino-4,6-pyrimidinedione;2-Amino-6-hydroxy-1H-pyrimidin-4-one;4,6-Dihydroxy-2-aminopyrimidine;2-amino-4, 6-dihydroxylpyrimidine; |
| CAS: | 56-09-7 |
| EINECS: | 200-256-5 |
| Molecular Formula: | C4H5N3O2 |
| Molecular Weight: | 127.1014 |
| InChI: | InChI=1S/C4H5N3O2/c5-4-6-2(8)1-3(9)7-4/h1H,(H4,5,6,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.84 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.752? |
| Water Solubility: | Insoluble in water, insoluble in common organic solvent, soluble in alkaline solution. |
| Solubility: | Insoluble in water, insoluble in common organic solvent, soluble in alkaline solution. |
| Appearance: | Slightly White powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Intermediate in the production of antimicrobial guanylsulfonamides. |
| Safety Data | |
 |
|
