| Identification | |
| Name: | Glycine |
| Synonyms: | L-Glycine;FEMA No. 3287;Leimzucker;aminoacetic acid;Glicoamin;Padil;Gly;Glyzin;Glycolixir;Glycosthene;2-Aminoacetic acid;Glycine (JP14/USP);Glycin;Amitone;Glycocoll;Glycine food grade;Aminoacetic acid(Glycine);H-Gly-OH (Physic Grade);H-Gly-OH; |
| CAS: | 56-40-6 |
| EINECS: | 200-272-2 |
| Molecular Formula: | C2H5NO2 |
| Molecular Weight: | 75.07 |
| InChI: | InChI=1/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 145 oC |
| Density: | 1.595 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Solubility: | 25g/100 ml |
| Appearance: | white to off-white crystalline powder |
| HS Code: | 29224910 |
| Biological Activity: | One of the major inhibitory neurotransmitters in the mammalian CNS, predominantly active in the spinal cord and brain stem. Also acts as a modulator of excitatory amino acid transmission mediated by NMDA receptors. Also available as part of the NMDA Receptor - Glycine Site Tocriset? . |
| Flash Point: | 145 oC |
| Color: | <5 (200?mg/mL)(APHA) |
| Usage: | Biologically significant amino acid. |
| Safety Data | |
 |
|
