| Identification |
| Name: | L-Alanine |
| Synonyms: | L-alanine-12C3; 2-Aminopropanoic Acid; H-Ala-OH~L-2-Aminopropionic acid; Ala; 2-Amino-Propionic Acid |
| CAS: | 56-41-7 |
| EINECS: | 200-273-8 |
| Molecular Formula: | C3H7NO2 |
| Molecular Weight: | 89.09 |
| InChI: | InChI=1/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.161 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Alpha: | 14.5 o (C=10,6N HCL,DRY SUB.) |
| Solubility: | 166.5 g/L (25 oC) in water |
| Appearance: | White crystalline powder |
| Specification: |
? L-Alanine ,?its cas register number is 56-41-7. It also can be called? (S)-2-Aminopropanoic acid ; (S)-2-Aminopropionsaeure ; (S)-Alanine ; (S)-alpha-Aminopropionsaeure ; 2-Aminopropanoic acid, L- ; Alanina ; Alanine ;
?Alaninum?; L-(+)-Alanine ; L-2-Aminopropanoic acid ; L-2-Aminopropionic acid ; L-2-Aminopropionsaeure ; L-S-Aminopropionic acid ; L-alpha-Aminopropionic acid ; Propanoic acid, 2-amino-, (S)- ; alpha-Aminopropionic acid .
|
| Report: |
Reported in EPA TSCA Inventory.
|
| HS Code: | 29224995 |
| Storage Temperature: | Store at RT. |
| Color: | Orthorhombic crystals from water White crystalline powder |
| Usage: | Microbiological & biochemical research. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |