| Identification | |
| Name: | 1,2,3-Propanetriol |
| Synonyms: | Glycerol (8CI);Propanetriol (7CI);1,2,3-Trihydroxypropane;E 422;Emery 916;Emery 917;G 101;GL 300;Glyceol Opthalgan;Glycerin;Glycerin DG;Glycerine;Glycyl alcohol;Glyrol;Glysanin;IFP;Incorporationfactor;Mackstat H 66;NSC 9230;Osmoglyn;Pricerine 9088;Pricerine 9091;Trihydroxypropane;Glycerol; |
| CAS: | 56-81-5 |
| EINECS: | 200-289-5 |
| Molecular Formula: | C3H5(OH)3 |
| Molecular Weight: | 92.09 |
| InChI: | InChI=1/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 250kgs in |
| Density: | 1.25 |
| Stability: | Stable. Incompatible with perchloric acid, lead oxide, acetic anhydride, nitrobenzene, chlorine, peroxides, strong acids, strong bases. Combustible. |
| Refractive index: | 1.452-1.475 |
| Solubility: | Miscible |
| Appearance: | Clear, colorless, viscous liquid |
| Specification: | Glycerol , its cas register number is 56-81-5. It also can be called Glycerine ; 1,2,3-Propanetriol ; Clyzerin, wasserfrei ; and 1,2,3-Trihydroxypropane ;Glycerin . |
| Packinggroup: | Z01 |
| HS Code: | 29054500 |
| Sensitive: | Hygroscopic |
| Color: | Syrupy, rhombic plates Cleas, colorless syrupy liquid Clear, colorless, syrupy liquid or solid (below 64 degrees F)[Note: The solid form melts above 64 degrees F but the liquid form freezes at a much lower temperature]. |
| Usage: | Cosmetics, hand lotions, adjuvant. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
