| Identification |
| Name: | L-Homocysteine,S-[(2R)-2-amino-2-carboxyethyl]- |
| Synonyms: | Cystathionine(6CI,7CI);Cystathionine, L- (8CI);L-Homocysteine,S-(2-amino-2-carboxyethyl)-, (R)-;Butanoic acid,2-amino-4-[(2-amino-2-carboxyethyl)thio]-, [R-(R*,S*)]-;L-(+)-Cystathionine;L-Cystathionine;S-[(2R)-2-Amino-2-carboxyethyl]-L-homocysteine;(2S)-2-Amino-4-[(2R)-2-amino-2-carboxyethyl]sulfanylbutanoic acid; |
| CAS: | 56-88-2 |
| EINECS: | 200-295-8 |
| Molecular Formula: | C7H14N2O4S |
| Molecular Weight: |
222.25 |
| InChI: | InChI=1/C7H14N2O4S/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5+/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 312 |
| Flash Point: | 244.7°C |
| Boiling Point: | 481°Cat760mmHg |
| Density: | 1.43g/cm3 |
| Refractive index: | 1.592 |
| Appearance: | White Crystalline Solid |
| Flash Point: | 244.7°C |
| Storage Temperature: | −20°C |
| Usage: | Intermediate in transsulfuration whereby the mammal transfers the sulfur of methionine via homocysteine to cysteine |
| Safety Data |
| |
 |
