| Identification |
| Name: | Benzoic acid, 4-(aminomethyl)- |
| Synonyms: | p-Toluicacid, a-amino- (6CI,8CI);4-(Aminomethyl)benzoic acid;4-Carboxybenzylamine;Aminomethylbenzoic acid;Benzylamine-4-carboxylic acid;Gumbix;NSC 41629;PAMBA;Styptopur;p-(Aminomethyl)benzoic acid;p-Carboxybenzylamine;a-Amino-p-toluic acid; |
| CAS: | 56-91-7 |
| EINECS: | 200-297-9 |
| Molecular Formula: | C8H9NO2 |
| Molecular Weight: | 151.16 |
| InChI: | InChI=1/C8H9NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5,9H2,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.239g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.598 |
| Appearance: | white to light yellow crystal powder |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
