| Identification |
| Name: | 3-Cyclohexen-1-ol,4-methyl-1-(1-methylethyl)- |
| Synonyms: | p-Menth-1-en-4-ol(8CI);1-(1-Methylethyl)-4-methyl-3-cyclohexen-1-ol;1-Isopropyl-4-methylcyclohex-3-en-1-ol;1-Terpinen-4-ol;4-Carvomenthenol;4-Methyl-1-(1-methylethyl)-3-cyclohexen-1-ol;4-Methyl-1-(1-methylethyl)-3-cyclohexene-1-ol;4-Methyl-1-isopropyl-3-cyclohexen-1-ol;4-Terpinenol;4-Terpineol;Melaleucol;NSC 147749;Terpin-4-ol;Terpinen-4-ol;Terpinene-4-ol;Terpineol-4;dl-4-Terpineol; |
| CAS: | 562-74-3 |
| EINECS: | 209-235-5 |
| Molecular Formula: | C10H18O |
| Molecular Weight: | 154.28 |
| InChI: | InChI=1/C10H18O/c1-8(2)10(11)6-4-9(3)5-7-10/h4,8,11H,5-7H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 82 ºC |
| Boiling Point: | 212 ºC |
| Density: | 0.929 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.476-1.482 |
| Water Solubility: | Very slightly soluble |
| Solubility: | Very slightly soluble |
| Appearance: | colourless or pale yellow liquid |
| Flash Point: | 82 ºC |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Shows antioxidant effects. Antiseptic. |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |
