Identification |
Name: | 3-Chloro-1-butene |
Synonyms: | -3-Chloro-1-butene; alpha-Methallyl chloride; 1-Methylallyl chloride |
CAS: | 563-52-0 |
EINECS: | 209-252-8 |
Molecular Formula: | C4H7Cl |
Molecular Weight: | 90.55 |
InChI: | InChI=1/C4H7Cl/c1-3-4(2)5/h3-4H,1H2,2H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 1993 3 |
Density: | 0.9 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.4145-1.4165 |
Water Solubility: | immiscible |
Solubility: | Immiscible with water |
Appearance: | Clear, colorless liquid. |
Packinggroup: | II |
Safety Data |
Hazard Symbols |
F:Flammable
|
|
 |