| Identification | |
| Name: | Glyoxylic acid monohydrate |
| Synonyms: | glyoxylic acid free acid monohydrate; Oxoacetic acid monohydrate; Glyoxalic Acid Monohydrate |
| CAS: | 563-96-2 |
| EINECS: | 206-058-5 |
| Molecular Formula: | C2H4O4 |
| Molecular Weight: | 92.05 |
| InChI: | InChI=1/C2H4O4/c3-1(4)2(5)6/h1,3-4H,(H,5,6)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 1.33 g/mL at 20 oC |
| Refractive index: | n20/D 1.414 |
| Water Solubility: | Freely soluble |
| Solubility: | Soluble |
| Appearance: | white to light yellow crystalline powder |
| Specification: |
Glyoxylic Acid Monohydrate, its cas register number is 563-96-2. It also can be called Dihydroxyacetic acid; Formylformic acid; Oxoethanoic acid, and its IUPAC name is (oxaldehydic acid hydrate. L-serine (CAS NO.56-45-1) is hygroscopic, it can absorbs moisture or water from the air. And it is incompatible with strong oxidizing agents,strong bases. L-serine's hazardous decomposition products are carbon monoxide, formaldehyde and carbon dioxide.Glyoxylic acid monohydrate (563-96-2) is a white to light yellow crystalline powder or chunks. In industrial field, Glyoxylic acid monohydrate (563-96-2) is used as a basic chemical for the synthesis of other chemical products of acids, esters, cyclic compounds. It should keep container tightly closed and keep container in a cool, well-ventilated area. |
| Packinggroup: | III |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
