| Identification | |
| Name: | Butanoic acid,4-(nitrosopropylamino)- |
| Synonyms: | N-Propyl-N-(3-carboxypropyl)nitrosamine |
| CAS: | 56316-37-1 |
| Molecular Formula: | C7H14 N2 O3 |
| Molecular Weight: | 174.23 |
| InChI: | InChI=1/C7H14N2O3/c1-2-5-9(8-12)6-3-4-7(10)11/h2-6H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 179.4°C |
| Boiling Point: | 373°Cat760mmHg |
| Density: | 1.14g/cm3 |
| Refractive index: | 1.494 |
| Specification: |
N-Propyl-N-(3-carboxypropyl)nitrosamine , its cas register number is 56316-37-1. It also can be called BRN 2250186 ; CCRIS 1249 ; and Butyric acid, 4-(N-nitrosopropylamino)- . |
| Flash Point: | 179.4°C |
| Safety Data | |
 |
|
