| Identification |
| Name: | 2-chloro-4-hydroxybenzoic acid |
| Synonyms: | 2-Chloro-4-hydroxybenzoic;2-Chloro-4-hydroxybenzoic acid |
| CAS: | 56363-84-9 |
| EINECS: | 260-132-1 |
| Molecular Formula: | C7H5ClO3 |
| Molecular Weight: | 172.57 |
| InChI: | InChI=1/C7H5ClO3/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3,9H,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 165.3°C |
| Boiling Point: | 349.6°Cat760mmHg |
| Density: | 1.536g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | off-white to beige or orange-brown cryst. powder |
| Flash Point: | 165.3°C |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
