Identification |
Name: | Acetic acid,2-amino-2-oxo-, sodium salt (1:1) |
Synonyms: | Aceticacid, aminooxo-, monosodium salt (9CI);Oxamic acid, monosodium salt (8CI);Oxamic acid, sodium salt (7CI);Sodium oxamate; |
CAS: | 565-73-1 |
EINECS: | 209-290-5 |
Molecular Formula: | C2H2NNaO3 |
Molecular Weight: | 111.03195 |
InChI: | InChI=1S/C2H3NO3.Na/c3-1(4)2(5)6;/h(H2,3,4)(H,5,6);/q;+1/p-1 |
Molecular Structure: |
|
Properties |
Density: | g/cm3 |
Water Solubility: | H2O: 50 mg/mL, clear, colorless |
Solubility: | H2O: 50 mg/mL, clear, colorless |
Appearance: | white crystalline powder |
Specification: | white crystalline powder Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
Storage Temperature: | Store at RT. |
Safety Data |
Hazard Symbols |
F: Flammable
|
|
|