| Identification |
| Name: | 2,4-Dimethyl-3-pentanone |
| Synonyms: | Diisopropyl ketone; ISOBUTYRONE; (iso-C3H7)2CO; 2,4-dimethyl-3-pentanon; 2,4-dimethyl-3-pentanone (diisopropyl ketone); 2,4-Dimethylpentan-3-on; 2,4-dimethyl-pentan-3-one |
| CAS: | 565-80-0 |
| EINECS: | 209-294-7 |
| Molecular Formula: | C7H14O |
| Molecular Weight: | 114.19 |
| InChI: | InChI=1/C7H14O/c1-5(2)7(8)6(3)4/h5-6H,1-4H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1224 |
| Density: | 0.806 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.399-1.402 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble |
| Appearance: | colorless to pale yellow liquid |
| Packinggroup: | II |
| HS Code: | 29141990 |
| Storage Temperature: | Flammables area |
| Safety Data |
| Hazard Symbols |
F:Flammable
Xn:Harmful
|
| |
 |
