| Identification | |
| Name: | D-Tryptophan, 6-chloro- |
| Synonyms: | 6-Chloro-D-tryptophan |
| CAS: | 56632-86-1 |
| Molecular Formula: | C11H11 Cl N2 O2 |
| Molecular Weight: | 238.67 |
| InChI: | InChI=1/C11H11ClN2O2/c12-7-1-2-8-6(3-9(13)11(15)16)5-14-10(8)4-7/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 242.2°C |
| Boiling Point: | 476.9°C at 760 mmHg |
| Density: | 1.474g/cm3 |
| Refractive index: | 1.701 |
| Specification: | Colourless Prisms usageEng:The unnatural enantiomer of Chlorotryptophan |
| Flash Point: | 242.2°C |
| Usage: | The unnatural enantiomer of Chlorotryptophan |
| Safety Data | |
 |
|
