| Identification | |
| Name: | Oxirane,2-[[4-(2-methoxyethyl)phenoxy]methyl]- |
| Synonyms: | Oxirane,[[4-(2-methoxyethyl)phenoxy]methyl]- (9CI); MEEPB |
| CAS: | 56718-70-8 |
| EINECS: | 260-353-3 |
| Molecular Formula: | C12H16 O3 |
| Molecular Weight: | 208.25364 |
| InChI: | InChI=1/C12H16O3/c1-13-7-6-10-2-4-11(5-3-10)14-8-12-9-15-12/h2-5,12H,6-9H2,1H3 |
| Molecular Structure: | ![(C12H16O3) Oxirane,[[4-(2-methoxyethyl)phenoxy]methyl]- (9CI); MEEPB](https://img1.guidechem.com/chem/e/dict/164/56718-70-8.jpg) |
| Properties | |
| Flash Point: | 100.1°C |
| Boiling Point: | 300.6°C at 760 mmHg |
| Density: | 1.099g/cm3 |
| Refractive index: | 1.521 |
| Appearance: | Pale-yellow oil |
| Specification: | Pale-Yellow Oil usageEng:Impurity of Metoprolol |
| Flash Point: | 100.1°C |
| Storage Temperature: | Refrigerator |
| Usage: | Impurity of Metoprolol |
| Safety Data | |
 |
|
