| Identification | |
| Name: | L-Serine methyl ester hydrochloride |
| CAS: | 5680-80-8 |
| EINECS: | 227-140-7 |
| Molecular Formula: | C4H10ClNO3 |
| Molecular Weight: | 155.58 |
| InChI: | InChI=1/C4H9NO3.ClH/c1-8-4(7)3(5)2-6;/h3,6H,2,5H2,1H3;1H/t3-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | 4.5 o (C=2, METHANOL) |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | White Solid |
| Specification: |
?Serine methyl ester , its cas register number is 5680-80-8. It also can be called?Methyl L-serinate hydrochloride?; L-Serine methyl ester hydrochloride ; Methyl serinatehydrochloride .It is a white solid. |
| HS Code: | 29225000 |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
