| Identification | |
| Name: | 2-Pyridinamine,N,N-dimethyl- |
| Synonyms: | Pyridine,2-(dimethylamino)- (6CI,7CI,8CI); 2,6-Dimethyl-3-pyridinylamine;2-(Dimethylamino)pyridine; N,N-Dimethyl-2-pyridinamine; N,N-Dimethylpyridin-2-ylamine;NSC 93902 |
| CAS: | 5683-33-0 |
| EINECS: | 227-147-5 |
| Molecular Formula: | C7H10 N2 |
| Molecular Weight: | 122.17 |
| InChI: | InChI=1/C7H10N2/c1-9(2)7-5-3-4-6-8-7/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1993 |
| Density: | 0.984 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.559 |
| Solubility: | Soluble |
| Appearance: | Clear colorless to pale yellow. |
| Specification: |
2-Dimethylaminopyridine with CAS registry number of 5683-33-0 is clear colorless to pale yellow liquid, also known as 2-Dimethylaminopyridin ; 2-Dimethylaminopyridine cobalt complex ; 5-22-08-00287 (Beilstein Handbook Reference) ; Dimethylamino-2 pyridine ; NSC 93902 ; 2-Pyridinamide, N,N-dimethyl- (9CI) ; 2-Pyridinamine, N,N-dimethyl- (9CI) ; N,N-Dimethylpyridin-2-amine ; Pyridine, 2-dimethylamino- . When heated to decomposition, it yields Nitrogen oxides, Carbon monoxide , irritating and toxic fumes and gases, Carbon dioxide , Nitrogen . |
| Packinggroup: | II |
| HS Code: | 29333999 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Flammables-area. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
