| Identification | |
| Name: | 1-Propanone,1-(4-ethylphenyl)-2-methyl-3-(1-piperidinyl)-, hydrochloride (1:1) |
| CAS: | 56839-43-1 |
| Molecular Formula: | C17H26ClNO |
| Molecular Weight: | 295.84744 |
| InChI: | InChI=1S/C17H25NO.ClH/c1-3-15-7-9-16(10-8-15)17(19)14(2)13-18-11-5-4-6-12-18;/h7-10,14H,3-6,11-13H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 168-174 ºC |
| Flash Point: | 137.4°C |
| Boiling Point: | 386.8°Cat760mmHg |
| Density: | 0.994g/cm3 |
| Water Solubility: | Easily soluble in water or methanol; slightly soluble in acetone; easily soluble in HCL solution |
| Solubility: | Easily soluble in water or methanol; slightly soluble in acetone; easily soluble in HCL solution |
| Appearance: | white or similar to white crystalline powder with peculiar smell and bitter taste |
| Specification: | White Solid usageEng:Used as antispasmodic |
| Flash Point: | 137.4°C |
| Usage: | Used as antispasmodic |
| Safety Data | |
 |
|
