| Identification | |
| Name: | Glycine,N-(aminoiminomethyl)-N-methyl- |
| Synonyms: | Creatine(8CI);Cosmocair C 100;Kre-Alkalyn;Methylguanidoacetic acid;N-Methyl-N-guanylglycine;NSC 8752;Neotine;Phosphagen;Tego Cosmo C 100; |
| CAS: | 57-00-1 |
| EINECS: | 200-306-6 |
| Molecular Formula: | C4H9N3O2 |
| Molecular Weight: | 131.13 |
| InChI: | InChI=1/C4H9N3O2/c1-7(4(5)6)2-3(8)9/h2H2,1H3,(H3,5,6)(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.38g/cm3 |
| Stability: | Stable in range pH 6-8; to light and heat. |
| Refractive index: | 1.506 (20 C) |
| Solubility: | practically insoluble |
| Appearance: | Very light, yellow colored liquid. |
| Storage Temperature: | Store at RT. |
| Usage: | Synergist for pyrethroids in aerosol sprays for household and veterinary use. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
