| Identification |
| Name: | Hexanoic acid,6-(acetylamino)- |
| Synonyms: | Hexanoicacid, 6-acetamido- (6CI,8CI); 6-(Acetylamino)hexanoic acid; 6-Acetamidocaproicacid; 6-Acetamidohexanoic acid; Acemin; Acetaminocaproic acid; Acexamic acid;CY 153; N-Acetyl-6-aminohexanoic acid; N-Acetyl-e-aminocaproic acid; NSC 12945; e-Acetamidocaproic acid |
| CAS: | 57-08-9 |
| EINECS: | 200-310-8 |
| Molecular Formula: | C8H15 N O3 |
| Molecular Weight: | 173.21 |
| InChI: | InChI=1/C8H15NO3/c1-7(10)9-6-4-2-3-5-8(11)12/h2-6H2,1H3,(H,9,10)(H,11,12) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.074g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | White. |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | Treatment of peptic ulsers when combined with zinc. |
| Safety Data |
| |
 |
