| Identification | |
| Name: | Palmitic acid |
| Synonyms: | Hexadecanoic acid; palmitic acid, pure; Palmitic Acid (1.00509); Palmitic acid tech; Hexadecan acid |
| CAS: | 57-10-3 |
| EINECS: | 200-312-9 |
| Molecular Formula: | C16H32O2 |
| Molecular Weight: | 256.42 |
| InChI: | InChI=1/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18) |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.852 |
| Stability: | Stable. Combustible. Incompatible with bases, oxidizing agents, reducing agents. |
| Refractive index: | 1.4273 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | white chips, crystals or powder |
| HS Code: | 29157015 |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | White crystalline scales Colorless needles Needles from alcohol |
| Usage: | Manufacture of metallic palmitates, soaps, lube oils, waterproofing, food-grade additives. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
