| Identification | |
| Name: | Boronic acid,B-(4-methylphenyl)- |
| Synonyms: | Boronicacid, (4-methylphenyl)- (9CI);p-Tolueneboronic acid (7CI,8CI);(4-Methylphenyl)boronic acid;(p-Methylphenyl)boronic acid;4-Tolueneboronic acid;NSC62870;p-Methylbenzeneboronic acid;p-Tolylboronic acid; |
| CAS: | 5720-05-8 |
| Molecular Formula: | C7H9BO2 |
| Molecular Weight: | 135.96 |
| InChI: | InChI=1/C7H9BO2/c1-6-2-4-7(5-3-6)8(9)10/h2-5,9-10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.1g/cm3 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
? 4-Tolylboronic acid , with CAS number of 5720-05-8, can be called 4-Tolylboronic acid ; 4-tolyboronic acid ; 4-methylbenzeneboronic acid ; 4-methylphenylboric acid ; 4-methylphenylboronic acid ; p-methylphenylboronic acid ; p-tolylboronic acid . It is a?white to light yellow crystal powder. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
