| Identification | |
| Name: | Boronic acid,B-(2-methoxyphenyl)- |
| Synonyms: | Benzeneboronicacid, o-methoxy- (6CI,7CI,8CI);Boronic acid, (2-methoxyphenyl)- (9CI);(2-Methoxyphenyl)boric acid;2-Methoxybenzeneboronic acid;[2-(Methyloxy)phenyl]boronic acid;o-Anisylboronicacid;o-Methoxybenzeneboronic acid;o-Methoxyphenylboronic acid; |
| CAS: | 5720-06-9 |
| Molecular Formula: | C7H9BO3 |
| Molecular Weight: | 151.96 |
| InChI: | InChI=1/C7H9BO3/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5,9-10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.17g/cm3 |
| Refractive index: | 1.524????? |
| Appearance: | white to light yellow crystal powder |
| Specification: | white to light yellow crystal powder usageEng:suzuki reaction Safety Statements:37/39-26-36 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Usage: | suzuki reaction |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
