Identification |
Name: | Boronicacid, B-(4-methoxyphenyl)- |
Synonyms: | Benzeneboronicacid, p-methoxy- (6CI,7CI,8CI);Boronic acid, (4-methoxyphenyl)- (9CI);(4-Methoxyphenyl)boric acid;(4-Methoxyphenyl)boronic acid;(p-Methoxyphenyl)boronic acid;4-Anisylboronic acid;4-Methoxybenzeneboronicacid;[4-(Methyloxy)phenyl]boronic acid;p-Anisylboronic acid;p-Methoxybenzeneboronic acid; |
CAS: | 5720-07-0 |
EINECS: | 216-845-5 |
Molecular Formula: | C7H9BO3 |
Molecular Weight: | 151.96 |
InChI: | InChI=1S/C7H9BO3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5,9-10H,1H3 |
Molecular Structure: |
 |
Properties |
Melting Point: | 208-210 oC |
Density: | 1.17g/cm3 |
Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
Appearance: | White to off-white powder. |
HS Code: | 29310095 |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |