| Identification | |
| Name: | 4-Biphenylacetic acid |
| Synonyms: | Felbinac |
| CAS: | 5728-52-9 |
| EINECS: | 227-233-2 |
| Molecular Formula: | C14H12O2 |
| Molecular Weight: | 212.24388 |
| InChI: | InChI=1S/C14H12O2/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Boiling Point: | 365 |
| Density: | 1.165 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | AUTOIGNITION |
| Solubility: | Soluble |
| Appearance: | Beige powder. |
| Specification: | Off-white powder usageEng:Anti-inflammatory, analgesic drug. Safety Statements:26-36/37/39-45-37/39-28A-26/36/3745/60-20-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 37/39:Wear suitable protective clothing, gloves and eye/face protection 20:When using, do not eat or drink 36:Wear suitable protective clothing |
| Packinggroup: | III |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Anti-inflammatory, analgesic drug. |
| Safety Data | |
 |
|
