| Identification |
| Name: | 2-Naphthalenol,1-bromo- |
| Synonyms: | 2-Naphthol,1-bromo- (7CI,8CI);1-Bromo-2-hydroxynaphthalene;1-Bromo-2-naphthol;1-Bromo-b-naphthol;1-Bromonaphthalen-2-ol;Disthemin;NSC 60275;Wormin;a-Bromo-b-naphthol; |
| CAS: | 573-97-7 |
| EINECS: | 209-363-1 |
| Molecular Formula: | C10H7BrO |
| Molecular Weight: | 223.07 |
| InChI: | InChI=1/C10H7BrO/c11-10-8-4-2-1-3-7(8)5-6-9(10)12/h1-6,12H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.614 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.704 |
| Solubility: | Insoluble |
| Appearance: | off-white to beige or brown-purple cryst. powder |
| HS Code: | 29081000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
