| Identification | |
| Name: | Ethanone,2-ethoxy-1,2-diphenyl- |
| Synonyms: | Acetophenone,2-ethoxy-2-phenyl- (7CI,8CI);2-Ethoxy-2-phenylacetophenone;2-Ethoxybenzoin;Benzoin ethyl ether;Ethoxybenzoin;Ethyl benzoin ether;PS 8A;Seikuol BEE;dl-Benzoin ethyl ether; |
| CAS: | 574-09-4 |
| EINECS: | 210-849-0 |
| Molecular Formula: | C16H16O2 |
| Molecular Weight: | 240.29704 |
| InChI: | InChI=1S/C16H16O2/c1-2-18-16(14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12,16H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 50kgs |
| Flash Point: | 152.3°C |
| Density: | 1.1016 |
| Refractive index: | 1.5727 |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION Appearance:white to off-white powder Transport Information:50kgs Hazard Symbols:UN NO. MSDS:View |
| Appearance: | white to off-white powder |
| Flash Point: | 152.3°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
