| Identification | |
| Name: | Pyridine,3-(2-pyrrolidinyl)- |
| CAS: | 5746-86-1 |
| EINECS: | 230-373-7 |
| Molecular Formula: | C9H12 N2 |
| Molecular Weight: | 148.20498 |
| InChI: | InChI=1S/C9H12N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1,3,5,7,9,11H,2,4,6H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 1.074 |
| Refractive index: | 1.54 |
| Water Solubility: | H2O: 50 mg/mL |
| Solubility: | H2O: 50 mg/mL |
| Appearance: | liquid |
| Specification: | Colourless Oil usageEng:A metabolite of Nicotine ((N412420). Can catalyze aqueous aldol reactions. Safety Statements:26-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Color: | yellow |
| Usage: | A metabolite of Nicotine. Can catalyze aqueous aldol reactions |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
