| Identification | |
| Name: | Glycine, L-g-glutamyl-S-nitroso-L-cysteinyl- |
| Synonyms: | Glycine,N-(N-L-g-glutamyl-S-nitroso-L-cysteinyl)-;Nitrosoglutathione;RVC 588 (peptide);S-Nitroso-L-glutathione;S-Nitrosoglutathione;S-Nitrosylglutathione;SNOG; |
| CAS: | 57564-91-7 |
| EINECS: | 248-170-7 |
| Molecular Formula: | C10H16N4O7S |
| Molecular Weight: | 336.32164 |
| InChI: | InChI=1S/C10H16N4O7S/c11-5(10(19)20)1-2-7(15)13-6(4-22-14-21)9(18)12-3-8(16)17/h5-6H,1-4,11H2,(H,12,18)(H,13,15)(H,16,17)(H,19,20)/t5-,6-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.68 g/cm3 |
| Water Solubility: | 25 mg/ml water, 10 mg/ml DMSO in water |
| Solubility: | 25 mg/ml water, 10 mg/ml DMSO in water |
| Appearance: | pink powder |
| Specification: | Pink Powder usageEng:A carrier of nitric oxide, relaxing smooth muscle and inhibiting platelet activation Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Biological Activity: | A carrier of NO, relaxing smooth muscle and inhibiting platelet aggregation. |
| Flash Point: | °C |
| Storage Temperature: | −20°C |
| Usage: | A carrier of nitric oxide, relaxing smooth muscle and inhibiting platelet activation |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
