| Identification |
| Name: | 2-Bromo-m-xylene |
| Synonyms: | 2,6-Dimethylbromobenzene; 2-Bromo-1,3-dimethylbenzene~2,6-Dimethylbromobenzene; 2-bromo-meta-xylene; 2-Fluoro-m-Xylene |
| CAS: | 576-22-7 |
| EINECS: | 209-397-7 |
| Molecular Formula: | C8H9Br |
| Molecular Weight: | 185.06 |
| InChI: | InChI=1/C8H9Br/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2810 |
| Density: | 1.389 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.554-1.556 |
| Appearance: | Clear slightly yellow liquid. |
| Packinggroup: | I; II; III |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
