| Identification | |
| Name: | O-Diisopropylbenzene |
| Synonyms: | 1,2-DI-ISO-PROPYLBENZENE;O-DIISOPROPYLBENZENE;1,2-di(propan-2-yl)benzene |
| CAS: | 577-55-9 |
| EINECS: | 209-412-7 |
| Molecular Formula: | C12H18 |
| Molecular Weight: | 162.27 |
| InChI: | InChI=1S/C12H18/c1-9(2)11-7-5-6-8-12(11)10(3)4/h5-10H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -57 deg C |
| Boiling Point: | 204 deg C at 760 mm Hg |
| Solubility: | Sol in all proportions of alcohol, ether, acetone and benzene. |
| Report: |
Reported in EPA TSCA Inventory. |
| Color: | Clear, colorless liquid |
| Safety Data | |
 |
|
