| Identification |
| Name: | Benzoic acid, 2-acetyl- |
| Synonyms: | Benzoicacid, o-acetyl- (6CI,7CI,8CI);2-Acetophenonecarboxylic acid;2'-Carboxyacetophenone;NSC 407680;o-Acetophenonecarboxylic acid;o-Acetylbenzoic acid;o-Carboxyacetophenone; |
| CAS: | 577-56-0 |
| EINECS: | 209-413-2 |
| Molecular Formula: | C9H8O3 |
| Molecular Weight: | 164.16 |
| InChI: | InChI=1/C9H8O3/c1-6(10)7-4-2-3-5-8(7)9(11)12/h2-5H,1H3,(H,11,12) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 174.448°C |
| Boiling Point: | 110 - 112 (2 torr) |
| Density: | 1.351g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.604 |
| Solubility: | Very soluble |
| Appearance: | Off-white solid. |
| HS Code: | 29183000 |
| Flash Point: | 174.448°C |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | A common component of hair dyes. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
