| Identification | |
| Name: | 4H-1-Benzopyran-4-one,3-hydroxy-2-phenyl- |
| Synonyms: | Flavone,3-hydroxy- (7CI,8CI); 3-HF; 3-Hydroxy-2-phenylchromone; 3-Hydroxyflavone;Flavon-3-ol; Flavonol; NSC 57653; NSC 58585; NSC 58586; NSC 58587 |
| CAS: | 577-85-5 |
| EINECS: | 209-416-9 |
| Molecular Formula: | C15H10 O3 |
| Molecular Weight: | 238.2381 |
| InChI: | InChI=1S/C15H10O3/c16-13-11-8-4-5-9-12(11)18-15(14(13)17)10-6-2-1-3-7-10/h1-9,17H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 171-172 ºC(lit.) |
| Flash Point: | 151.5 ºC |
| Boiling Point: | 393.7 ºC at 760 mmHg |
| Density: | 1.367 g/cm3 |
| Refractive index: | 1.679 |
| Solubility: | Soluble in ethanol In water, 28.9 mg/L at 25 deg C (est) |
| Specification: |
3-Hydroxyflavone (CAS NO.577-85-5) is a chemical compound. It is the backbone of all flavonols, a type of flavonoid. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 151.5 ºC |
| Storage Temperature: | 0-6°C |
| Color: | Yellow needles Pale yellow needles from alcohol Violet flourescence in concentrated sulfuric acid |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
