| Identification | |
| Name: | o-bromoanisole |
| Synonyms: | 1-Bromo-2-methoxybenzene; |
| CAS: | 578-57-4 |
| EINECS: | 209-425-8 |
| Molecular Formula: | C7H7BrO |
| Molecular Weight: | 187.03388 |
| InChI: | InChI=1S/C7H7BrO/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 9/PG 3 |
| Density: | 1.5 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.573-1.575 |
| Water Solubility: | immiscible |
| Solubility: | immiscible |
| Appearance: | colorless or light yellow liquid |
| Specification: | colourless liquid Safety Statements:61-24/25 61:Avoid release to the environment. Refer to special instructions safety data sheet 24/25:Avoid contact with skin and eyes |
| HS Code: | 29093038 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
N:Dangerousfortheenvironment
|
 |
|
