| Identification | |
| Name: | ACRIDONE |
| Synonyms: | 9(10H)-Acridone; 9,10-Dihydro-9-oxoacridine; 9-Acridone |
| CAS: | 578-95-0 |
| EINECS: | 209-434-7 |
| Molecular Formula: | C13H9NO |
| Molecular Weight: | 195.22 |
| InChI: | InChI=1/C13H9NO/c15-13-9-5-1-3-7-11(9)14-12-8-4-2-6-10(12)13/h1-8H,(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 155.049 oC |
| Boiling Point: | 355 oC at 760 mmHg |
| Density: | 1.23 g/cm3 |
| Refractive index: | 1.642 |
| Appearance: | light yellow to gold crystalline powder |
| Specification: |
? 9-Acridone (CAS NO.578-95-0), its Synonyms are Acridone ; Acridanone ; Acridin-9-one ; Acridine, 9,10-dihydro-9-oxo- ; 7H-Dibenz(a,j)acrid-14-one ; 9(10H)-Acridinone . It is yellow crystalline powder. |
| Report: |
It is reported in EPA TSCA Inventory. |
| Flash Point: | 155.049 oC |
| Storage Temperature: | Refrigerator |
| Usage: | A precursor molecule to several chemotherapeutic agents. A catabolic product of carbamazepine (C175840) metabolite. Used as a fluorescent tag for antibody catalysis. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
