| Identification |
| Name: | Benzoic acid,2-methoxy- |
| Synonyms: | NSC 3778;O-Methylsalicylic acid;Salicylicacid methyl ether;o-Methoxybenzoic acid; |
| CAS: | 579-75-9 |
| EINECS: | 209-447-8 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.14732 |
| InChI: | InChI=1S/C8H8O3/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Melting Point: | 99 - 101 C |
| Flash Point: | 116 |
| Boiling Point: | 200 C |
| Density: | 1.38 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | White to off-white crystalline powder |
| Specification: | White to off-white crystalline powder Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| HS Code: | 29189090 |
| Flash Point: | 116 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
|
| |
 |