| Identification | ||
| Name: | 2,4-Pyrimidinediamine,5-(4-chlorophenyl)-6-ethyl- | |
| Synonyms: | 2,4-Diamino-5-(p-chlorophenyl)-6-ethylpyrimidine;5-(4-Chlorophenyl)-6-ethyl-2,4-pyrimidinediamine; | |
| CAS: | 58-14-0 | |
| EINECS: | 200-364-2 | |
| Molecular Formula: | C12H13ClN4 | |
| Molecular Weight: | 248.71 | |
| InChI: | InChI=1/C12H13ClN4/c1-2-9-10(11(14)17-12(15)16-9)7-3-5-8(13)6-4-7/h3-6H,2H2,1H3,(H4,14,15,16,17) | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 3249 | |
| Density: | 1.305g/cm3 | |
| Stability: | Stable, but light sensitive. Combustible. Incompatible with strong oxidizing agents. | |
| Refractive index: | 1.655 | |
| Water Solubility: | <0.01 g/100 mL at 21 ºC | |
| Solubility: | <0.01 g/100 mL at 21 oC | |
| Appearance: | white powder | |
| Specification: | White Solid usageEng:Dihydrofolate reductase inhibitor; generally used in combination with other antimicrobial agents. Antiprotozoal (Toxoplasma); antimalarial | |
| Packinggroup: | III | |
| Biological Activity: | Potent inhibitor of multi-drug and toxin extrusion (MATE) transporters (K i values are 46 and 77 nM for human MATE2-K-HEK293 and MATE1-HEK293 cells respectively). Also inhibits dihydrofolate reductase (DHFR). | |
| Usage: | Dihydrofolate reductase inhibitor; generally used in combination with other antimicrobial agents. Antiprotozoal (Toxoplasma); antimalarial | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
