| Identification | |
| Name: | Menadione |
| Synonyms: | 1,4-Naphthalenedione,2-methyl-;2-Methyl-1,4-naphthalenedione;Kipca;VK3;Karcon;Kayklot;Kanone;Kayquinone;Memodol;Menaquinone 0;Kappaxin;Aquakay;2-Methylnaphthoquinone;Menadionum;Klottone;Kappaxin (TN);3-Methyl-1,4-naphthoquinone;K-Thrombyl;2-Methyl-1,4-naphthochinon [German];Synkay;Methyl-1,4-naphthoquinone;Methyl-1,4-naphthalenedione;Usaf ek-5185;Kappaxan (VAN);Mitenone;2-Methyl-1,4-naftochinon [Czech];Prestwick_313;Menadion;2-Methyl-1,4-naphthochinon;Vitamin K3;1,4-Naphthoquinone, 2-methyl-;Juva-K;1,4-Naphthalenedione, 2-methyl-;Riboflavin (Vitamin B2);Kolklot;Vitamin K2 (0);Hemodal;1, 4-Naphthoquinone, 2-methyl-;Koaxin;Menaphthone;Kaykot;Menaphthon;MNQ;Kaergona;2-methyl-1,4-dihydronaphthalene-1,4-dione; |
| CAS: | 58-27-5 |
| EINECS: | 200-372-6 |
| Molecular Formula: | C11H8O2 |
| Molecular Weight: | 172.18 |
| InChI: | InChI=1/C11H8O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.225 g/cm3 |
| Stability: | Stable. May be light sensitive. Incompatible with strong oxidizing agents. |
| Water Solubility: | INSOLUBLE |
| Solubility: | Soluble |
| Appearance: | Bright yellow crystals |
| Specification: |
? Menadione ,?its cas register number is 58-27-5. It also can be called?1,4-Naphthalenedione, 2-methyl- ; 2-Methyl-1,4-naphthochinon ; 2-Methylnaphthoquinone ; 3-Methyl-1,4-naphthoquinone ; Aquakay ; Aquinone ; Kayquinone ; Kipca ; |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store at RT. |
| Sensitive: | Light Sensitive |
| Color: | yellow |
| Usage: | Precursor to verious types of Vitamin K. Used as a micronutrient for livestock and pet foods. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
