| Identification | |
| Name: | 1H-Purine-2,6-dione,3,9-dihydro-1,3-dimethyl- |
| Synonyms: | 1H-Purine-2,6-dione,3,7-dihydro-1,3-dimethyl- (9CI);Theophylline (8CI);1,3-Dimethylxanthine;Accurbron;Aerobin;Aerolate;Afonilm;Apnecut;Armophylline;Asmax;Austyn;Bilordyl;Brochoretard;Bronkodyl;Cetraphylline;Chronophyllin;Diffumal;Duraphyl;Egifilin;Elixophyllin;Etheophyl;Euphylong;LaBID;Lanophyllin;Nuelin;Optiphyllin;Parkophyllin;Physpan;Pro-Vent;PulmiDur;Pulmo-Timelets;Quibron T/SR;Respbid;Respicur;Solosin;SomophyllinCRT;Somophyllin T;Spophyllin retard;Sustaire;Talotren;Telb-DS;Telbans;Telbans Dry Syrup;Teonova;Theo 24;Theo-Dur;Theo-Sav;Theobid;Theobid Duracap;Theoclear;Theodel;Theodrip;Theodur Dry Syrup;Theograd;Theolair;Theona P;Theopek;Theoplus;Theostat;Theotard;Theovent;Throphylline;Unicontin CR;Unilong;Uniphyl;Uniphyllin;Xanthium;Zydus; |
| CAS: | 58-55-9 |
| EINECS: | 200-385-7 |
| Molecular Formula: | C7H8N4O2 |
| Molecular Weight: | 180.16 |
| InChI: | InChI=1/C7H8N4O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h3H,1-2H3,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.465 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.737 |
| Solubility: | Soluble in hot water, alkaline solution. |
| Appearance: | white to off-white crystalline powder |
| Specification: |
?Theophylline (CAS NO.58-55-9), its Synonyms are Theophylline anhydrous ; 1,3-Dimethylxanthine ; 3,7-Dihydro-1,3-dimethyl-1H-purine-2,6-dione ; Acet-theocin ; Aerolate ; Aerolate III ; Armophylline ; Lanophyllin ; Liquophylline ; Maphylline ; Medaphyllin ; Pseudotheophylline ; Purine-2,6(1H,3H)-dione, 1,3-dimethyl- . It is odorless white crystalline powder and bitter taste. |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| Biological Activity: | Bronchodilator, anti-inflammatory and immunomodulator. Antagonizes adenosine receptors and is a weak non-selective inhibitor of phosphodiesterases (PDEs). |
| Color: | white |
| Usage: | Medication (vet). |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
