| Identification | |
| Name: | Adenosine |
| CAS: | 58-61-7 |
| EINECS: | 200-389-9 |
| Molecular Formula: | C10H13N5O4 |
| Molecular Weight: | 267.24132 |
| InChI: | InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 2.08 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.907 |
| Water Solubility: | soluble (soluble in caustic soda) |
| Solubility: | soluble (soluble in caustic soda) |
| Appearance: | white crystalline powder |
| Specification: | White crystalline powder Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Biological Activity: | Neurotransmitter that acts as the preferred endogenous agonist at all adenosine receptor subtypes. |
| Color: | Crystals from water Needles from water |
| Usage: | Nucleoside, neurotransmitter. |
| Safety Data | |
| Hazard Symbols | |
 |
|
