| Identification |
| Name: | 6-Hydroxyquinoline |
| Synonyms: | 1H-1,6-Epoxyquinoline;NSC 26343;Quinolin-6-ol; |
| CAS: | 580-16-5 |
| EINECS: | 209-454-6 |
| Molecular Formula: | C9H7NO |
| Molecular Weight: | 145.16 |
| InChI: | InChI=1/C9H7NO/c11-8-3-4-9-7(6-8)2-1-5-10-9/h1-6,11H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.26 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | almost insoluble |
| Solubility: | almost insoluble |
| Appearance: | Light Brown To Grey Powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
