| Identification | |
| Name: | 2-Quinolinamine |
| Synonyms: | Quinoline,1,2-dihydro-2-imino- (4CI); Quinoline, 2-amino- (8CI); 2-Aminoquinoline;2-Quinolinylamine; NSC 57739; NSC 58387 |
| CAS: | 580-22-3 |
| EINECS: | 209-458-8 |
| Molecular Formula: | C9H8 N2 |
| Molecular Weight: | 144.18 |
| InChI: | InChI=1/C9H8N2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H,(H2,10,11)/p+1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Melting Point: | 120 - 122 C |
| Flash Point: | 163.6°C |
| Boiling Point: | 304.9°Cat760mmHg |
| Density: | 1.21g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | |
| Water Solubility: | soluble |
| Solubility: | Soluble |
| Appearance: | light yellow crystals |
| Specification: | colorless to light yellow liquid Safety Statements:26-36/37/39-22 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 22:Do not breathe dust |
| Flash Point: | 163.6°C |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
